C20H18ClFN2O3 — CID 68506647
2-[2-[4-(3-chloropropoxy)phenyl]-1,3-oxazol-4-yl]-N-(4-fluorophenyl)acetamide (PubChem CID 68506647) has the molecular formula C20H18ClFN2O3 and a molecular weight of 388.83 g/mol. Its IUPAC name is 2-[2-[4-(3-chloropropoxy)phenyl]-1,3-oxazol-4-yl]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[2-[4-(3-chloropropoxy)phenyl]-1,3-oxazol-4-yl]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 68506647 |
| Molecular Formula | C20H18ClFN2O3 |
| Molecular Weight | 388.83 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 2-[2-[4-(3-chloropropoxy)phenyl]-1,3-oxazol-4-yl]-N-(4-fluorophenyl)acetamide |
| SMILES | O=C(Cc1coc(-c2ccc(OCCCCl)cc2)n1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C20H18ClFN2O3/c21-10-1-11-26-18-8-2-14(3-9-18)20-24-17(13-27-20)12-19(25)23-16-6-4-15(22)5-7-16/h2-9,13H,1,10-12H2,(H,23,25) |
| InChIKey | RQDZEWVQOAHLBV-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.83 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|