C30H33N3O4 — CID 68506892
(2S,3S)-3-[[2-(4-methoxyphenyl)-3-(4-methylphenyl)-4,5,6,7-tetrahydroindazole-7-carbonyl]amino]bicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 68506892) has the molecular formula C30H33N3O4 and a molecular weight of 499.61 g/mol. Its IUPAC name is (2S,3S)-3-[[2-(4-methoxyphenyl)-3-(4-methylphenyl)-4,5,6,7-tetrahydroindazole-7-carbonyl]amino]bicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | (2S,3S)-3-[[2-(4-methoxyphenyl)-3-(4-methylphenyl)-4,5,6,7-tetrahydroindazole-7-carbonyl]amino]bicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 68506892 |
| Molecular Formula | C30H33N3O4 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | (2S,3S)-3-[[2-(4-methoxyphenyl)-3-(4-methylphenyl)-4,5,6,7-tetrahydroindazole-7-carbonyl]amino]bicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | COc1ccc(-n2nc3c(c2-c2ccc(C)cc2)CCCC3C(=O)N[C@H]2C3CCC(C3)[C@@H]2C(=O)O)cc1 |
| InChI | InChI=1S/C30H33N3O4/c1-17-6-8-18(9-7-17)28-23-4-3-5-24(27(23)32-33(28)21-12-14-22(37-2)15-13-21)29(34)31-26-20-11-10-19(16-20)25(26)30(35)36/h6-9,12-15,19-20,24-26H,3-5,10-11,16H2,1-2H3,(H,31,34)(H,35,36)/t19?,20?,24?,25-,26-/m0/s1 |
| InChIKey | JJGFUPUQNOFARW-JFOUEQLDSA-N |
| XLogP | 4.89 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |