C14H14FNO3 — CID 68507023
2-[(7S)-4-fluoro-7-hydroxy-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]acetic acid (PubChem CID 68507023) has the molecular formula C14H14FNO3 and a molecular weight of 263.27 g/mol. Its IUPAC name is 2-[(7S)-4-fluoro-7-hydroxy-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]acetic acid.
| Compound Name | 2-[(7S)-4-fluoro-7-hydroxy-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]acetic acid |
|---|---|
| PubChem CID | 68507023 |
| Molecular Formula | C14H14FNO3 |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 2-[(7S)-4-fluoro-7-hydroxy-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]acetic acid |
| SMILES | O=C(O)Cc1c2n(c3c(F)cccc13)C[C@@H](O)CC2 |
| InChI | InChI=1S/C14H14FNO3/c15-11-3-1-2-9-10(6-13(18)19)12-5-4-8(17)7-16(12)14(9)11/h1-3,8,17H,4-7H2,(H,18,19)/t8-/m0/s1 |
| InChIKey | JBPDIXYCCDFLCN-QMMMGPOBSA-N |
| XLogP | 1.71 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|