About 2-methylpropanedithioic acid
2-methylpropanedithioic acid (PubChem CID 6850726) has the molecular formula C4H8S2
and a molecular weight of 120.24 g/mol. Its IUPAC name is 2-methylpropanedithioic acid.
Molecular Properties
| Compound Name | 2-methylpropanedithioic acid |
| PubChem CID | 6850726 |
| Molecular Formula | C4H8S2 |
| Molecular Weight | 120.24 g/mol |
| Exact Mass | 120.01 |
| IUPAC Name | 2-methylpropanedithioic acid |
| SMILES | CC(C)C(=S)S |
| InChI | InChI=1S/C4H8S2/c1-3(2)4(5)6/h3H,1-2H3,(H,5,6) |
| InChIKey | OAZPGUICIFMRKI-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.24 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropanedithioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropanedithioic acid?
The IUPAC name of 2-methylpropanedithioic acid (CID 6850726) is 2-methylpropanedithioic acid.
What is the SMILES notation for 2-methylpropanedithioic acid?
The canonical SMILES for 2-methylpropanedithioic acid is CC(C)C(=S)S.
What is the InChIKey of 2-methylpropanedithioic acid?
The InChIKey is OAZPGUICIFMRKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8S2/c1-3(2)4(5)6/h3H,1-2H3,(H,5,6).
What are the key properties of 2-methylpropanedithioic acid?
2-methylpropanedithioic acid has a molecular weight of 120.24 g/mol, XLogP of 1.90, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropanedithioic acid is sourced from PubChem (CID 6850726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).