C23H20F2N4O2 — CID 68507279
2-[5-(3,5-difluorophenoxy)-2-methyl-1,3,4,5-tetrahydro-2-benzazepin-8-yl]-[1,2,4]triazolo[4,3-a]pyridin-3-one (PubChem CID 68507279) has the molecular formula C23H20F2N4O2 and a molecular weight of 422.44 g/mol. Its IUPAC name is 2-[5-(3,5-difluorophenoxy)-2-methyl-1,3,4,5-tetrahydro-2-benzazepin-8-yl]-[1,2,4]triazolo[4,3-a]pyridin-3-one.
| Compound Name | 2-[5-(3,5-difluorophenoxy)-2-methyl-1,3,4,5-tetrahydro-2-benzazepin-8-yl]-[1,2,4]triazolo[4,3-a]pyridin-3-one |
|---|---|
| PubChem CID | 68507279 |
| Molecular Formula | C23H20F2N4O2 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 2-[5-(3,5-difluorophenoxy)-2-methyl-1,3,4,5-tetrahydro-2-benzazepin-8-yl]-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| SMILES | CN1CCC(Oc2cc(F)cc(F)c2)c2ccc(-n3nc4ccccn4c3=O)cc2C1 |
| InChI | InChI=1S/C23H20F2N4O2/c1-27-9-7-21(31-19-12-16(24)11-17(25)13-19)20-6-5-18(10-15(20)14-27)29-23(30)28-8-3-2-4-22(28)26-29/h2-6,8,10-13,21H,7,9,14H2,1H3 |
| InChIKey | WPFVKABBQMSLTE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 51.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |