C24H28ClN3O3 — CID 68507472
1-[4-[1-(4-chlorobenzoyl)-4-hydroxypyrrolidin-3-yl]piperazin-1-yl]-3-phenylpropan-1-one (PubChem CID 68507472) has the molecular formula C24H28ClN3O3 and a molecular weight of 441.96 g/mol. Its IUPAC name is 1-[4-[1-(4-chlorobenzoyl)-4-hydroxypyrrolidin-3-yl]piperazin-1-yl]-3-phenylpropan-1-one.
| Compound Name | 1-[4-[1-(4-chlorobenzoyl)-4-hydroxypyrrolidin-3-yl]piperazin-1-yl]-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 68507472 |
| Molecular Formula | C24H28ClN3O3 |
| Molecular Weight | 441.96 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 1-[4-[1-(4-chlorobenzoyl)-4-hydroxypyrrolidin-3-yl]piperazin-1-yl]-3-phenylpropan-1-one |
| SMILES | O=C(CCc1ccccc1)N1CCN(C2CN(C(=O)c3ccc(Cl)cc3)CC2O)CC1 |
| InChI | InChI=1S/C24H28ClN3O3/c25-20-9-7-19(8-10-20)24(31)28-16-21(22(29)17-28)26-12-14-27(15-13-26)23(30)11-6-18-4-2-1-3-5-18/h1-5,7-10,21-22,29H,6,11-17H2 |
| InChIKey | VZXMDDCHNIJCCL-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.96 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |