C16H34O2 — CID 6850793
2,2,4-trimethyl-1,3-bis(2-methylpropoxy)pentane (PubChem CID 6850793) has the molecular formula C16H34O2 and a molecular weight of 258.45 g/mol. Its IUPAC name is 2,2,4-trimethyl-1,3-bis(2-methylpropoxy)pentane.
| Compound Name | 2,2,4-trimethyl-1,3-bis(2-methylpropoxy)pentane |
|---|---|
| PubChem CID | 6850793 |
| Molecular Formula | C16H34O2 |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.26 |
| IUPAC Name | 2,2,4-trimethyl-1,3-bis(2-methylpropoxy)pentane |
| SMILES | CC(C)COCC(C)(C)C(OCC(C)C)C(C)C |
| InChI | InChI=1S/C16H34O2/c1-12(2)9-17-11-16(7,8)15(14(5)6)18-10-13(3)4/h12-15H,9-11H2,1-8H3 |
| InChIKey | SDTQRBYCFCFJPW-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |