C14H20F2N2O6 — CID 68508141
(3S)-4-(3,3-difluoro-2,6-dioxopiperidin-1-yl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (PubChem CID 68508141) has the molecular formula C14H20F2N2O6 and a molecular weight of 350.32 g/mol. Its IUPAC name is (3S)-4-(3,3-difluoro-2,6-dioxopiperidin-1-yl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid.
| Compound Name | (3S)-4-(3,3-difluoro-2,6-dioxopiperidin-1-yl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
|---|---|
| PubChem CID | 68508141 |
| Molecular Formula | C14H20F2N2O6 |
| Molecular Weight | 350.32 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | (3S)-4-(3,3-difluoro-2,6-dioxopiperidin-1-yl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)O)CN1C(=O)CCC(F)(F)C1=O |
| InChI | InChI=1S/C14H20F2N2O6/c1-13(2,3)24-12(23)17-8(6-10(20)21)7-18-9(19)4-5-14(15,16)11(18)22/h8H,4-7H2,1-3H3,(H,17,23)(H,20,21)/t8-/m0/s1 |
| InChIKey | SOFMBILNXXSKSR-QMMMGPOBSA-N |
| XLogP | 1.14 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.32 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|