C23H20Cl2N2O3 — CID 68508197
1-(5,8-dichloro-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-3-quinolin-3-ylprop-2-en-1-one (PubChem CID 68508197) has the molecular formula C23H20Cl2N2O3 and a molecular weight of 443.33 g/mol. Its IUPAC name is 1-(5,8-dichloro-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-3-quinolin-3-ylprop-2-en-1-one.
| Compound Name | 1-(5,8-dichloro-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-3-quinolin-3-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 68508197 |
| Molecular Formula | C23H20Cl2N2O3 |
| Molecular Weight | 443.33 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | 1-(5,8-dichloro-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-3-quinolin-3-ylprop-2-en-1-one |
| SMILES | COc1c(Cl)c2c(c(Cl)c1OC)CN(C(=O)C=Cc1cnc3ccccc3c1)CC2 |
| InChI | InChI=1S/C23H20Cl2N2O3/c1-29-22-20(24)16-9-10-27(13-17(16)21(25)23(22)30-2)19(28)8-7-14-11-15-5-3-4-6-18(15)26-12-14/h3-8,11-12H,9-10,13H2,1-2H3 |
| InChIKey | KVWTWXPYDHHBML-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.33 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|