C23H25N3O2 — CID 68508258
(E,4R)-4-hydroxy-1-(2-phenylpyrazolo[1,5-a]pyridin-3-yl)-5-piperidin-1-ylpent-1-en-3-one (PubChem CID 68508258) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is (E,4R)-4-hydroxy-1-(2-phenylpyrazolo[1,5-a]pyridin-3-yl)-5-piperidin-1-ylpent-1-en-3-one.
| Compound Name | (E,4R)-4-hydroxy-1-(2-phenylpyrazolo[1,5-a]pyridin-3-yl)-5-piperidin-1-ylpent-1-en-3-one |
|---|---|
| PubChem CID | 68508258 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | (E,4R)-4-hydroxy-1-(2-phenylpyrazolo[1,5-a]pyridin-3-yl)-5-piperidin-1-ylpent-1-en-3-one |
| SMILES | O=C(/C=C/c1c(-c2ccccc2)nn2ccccc12)[C@H](O)CN1CCCCC1 |
| InChI | InChI=1S/C23H25N3O2/c27-21(22(28)17-25-14-6-2-7-15-25)13-12-19-20-11-5-8-16-26(20)24-23(19)18-9-3-1-4-10-18/h1,3-5,8-13,16,22,28H,2,6-7,14-15,17H2/b13-12+/t22-/m1/s1 |
| InChIKey | YUGSTXFYSZMJCJ-CHHLAKQQSA-N |
| XLogP | 3.43 |
| TPSA | 57.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|