About (1S)-1-cyclohexylethanamine;2,2,2-trifluoroacetic acid
(1S)-1-cyclohexylethanamine;2,2,2-trifluoroacetic acid (PubChem CID 68508267) has the molecular formula C10H18F3NO2
and a molecular weight of 241.25 g/mol. Its IUPAC name is (1S)-1-cyclohexylethanamine;2,2,2-trifluoroacetic acid.
Molecular Properties
| Compound Name | (1S)-1-cyclohexylethanamine;2,2,2-trifluoroacetic acid |
| PubChem CID | 68508267 |
| Molecular Formula | C10H18F3NO2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | (1S)-1-cyclohexylethanamine;2,2,2-trifluoroacetic acid |
| SMILES | C[C@H](N)C1CCCCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C8H17N.C2HF3O2/c1-7(9)8-5-3-2-4-6-8;3-2(4,5)1(6)7/h7-8H,2-6,9H2,1H3;(H,6,7)/t7-;/m0./s1 |
| InChIKey | LEPPTTXABDYABC-FJXQXJEOSA-N |
| XLogP | 2.55 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S)-1-cyclohexylethanamine;2,2,2-trifluoroacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-cyclohexylethanamine;2,2,2-trifluoroacetic acid?
The IUPAC name of (1S)-1-cyclohexylethanamine;2,2,2-trifluoroacetic acid (CID 68508267) is (1S)-1-cyclohexylethanamine;2,2,2-trifluoroacetic acid.
What is the SMILES notation for (1S)-1-cyclohexylethanamine;2,2,2-trifluoroacetic acid?
The canonical SMILES for (1S)-1-cyclohexylethanamine;2,2,2-trifluoroacetic acid is C[C@H](N)C1CCCCC1.O=C(O)C(F)(F)F.
What is the InChIKey of (1S)-1-cyclohexylethanamine;2,2,2-trifluoroacetic acid?
The InChIKey is LEPPTTXABDYABC-FJXQXJEOSA-N. The full InChI is InChI=1S/C8H17N.C2HF3O2/c1-7(9)8-5-3-2-4-6-8;3-2(4,5)1(6)7/h7-8H,2-6,9H2,1H3;(H,6,7)/t7-;/m0./s1.
What are the key properties of (1S)-1-cyclohexylethanamine;2,2,2-trifluoroacetic acid?
(1S)-1-cyclohexylethanamine;2,2,2-trifluoroacetic acid has a molecular weight of 241.25 g/mol, XLogP of 2.55, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-cyclohexylethanamine;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 68508267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).