About 2,2-diethyl-N'-(4-phenoxyphenyl)sulfonylpropanediamide
2,2-diethyl-N'-(4-phenoxyphenyl)sulfonylpropanediamide (PubChem CID 68508410) has the molecular formula C19H22N2O5S
and a molecular weight of 390.46 g/mol. Its IUPAC name is 2,2-diethyl-N'-(4-phenoxyphenyl)sulfonylpropanediamide.
Molecular Properties
| Compound Name | 2,2-diethyl-N'-(4-phenoxyphenyl)sulfonylpropanediamide |
| PubChem CID | 68508410 |
| Molecular Formula | C19H22N2O5S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 2,2-diethyl-N'-(4-phenoxyphenyl)sulfonylpropanediamide |
| SMILES | CCC(CC)(C(N)=O)C(=O)NS(=O)(=O)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C19H22N2O5S/c1-3-19(4-2,17(20)22)18(23)21-27(24,25)16-12-10-15(11-13-16)26-14-8-6-5-7-9-14/h5-13H,3-4H2,1-2H3,(H2,20,22)(H,21,23) |
| InChIKey | SGAQALRPTQVEIM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2,2-diethyl-N'-(4-phenoxyphenyl)sulfonylpropanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-diethyl-N'-(4-phenoxyphenyl)sulfonylpropanediamide?
The IUPAC name of 2,2-diethyl-N'-(4-phenoxyphenyl)sulfonylpropanediamide (CID 68508410) is 2,2-diethyl-N'-(4-phenoxyphenyl)sulfonylpropanediamide.
What is the SMILES notation for 2,2-diethyl-N'-(4-phenoxyphenyl)sulfonylpropanediamide?
The canonical SMILES for 2,2-diethyl-N'-(4-phenoxyphenyl)sulfonylpropanediamide is CCC(CC)(C(N)=O)C(=O)NS(=O)(=O)c1ccc(Oc2ccccc2)cc1.
What is the InChIKey of 2,2-diethyl-N'-(4-phenoxyphenyl)sulfonylpropanediamide?
The InChIKey is SGAQALRPTQVEIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O5S/c1-3-19(4-2,17(20)22)18(23)21-27(24,25)16-12-10-15(11-13-16)26-14-8-6-5-7-9-14/h5-13H,3-4H2,1-2H3,(H2,20,22)(H,21,23).
What are the key properties of 2,2-diethyl-N'-(4-phenoxyphenyl)sulfonylpropanediamide?
2,2-diethyl-N'-(4-phenoxyphenyl)sulfonylpropanediamide has a molecular weight of 390.46 g/mol, XLogP of 2.58, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diethyl-N'-(4-phenoxyphenyl)sulfonylpropanediamide is sourced from PubChem (CID 68508410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).