C22H24N2O4 — CID 68510211
4-(3,4-dihydro-1H-isoquinolin-2-yl)-2-[ethyl(phenyl)carbamoyl]-4-oxobutanoic acid (PubChem CID 68510211) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is 4-(3,4-dihydro-1H-isoquinolin-2-yl)-2-[ethyl(phenyl)carbamoyl]-4-oxobutanoic acid.
| Compound Name | 4-(3,4-dihydro-1H-isoquinolin-2-yl)-2-[ethyl(phenyl)carbamoyl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 68510211 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 4-(3,4-dihydro-1H-isoquinolin-2-yl)-2-[ethyl(phenyl)carbamoyl]-4-oxobutanoic acid |
| SMILES | CCN(C(=O)C(CC(=O)N1CCc2ccccc2C1)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C22H24N2O4/c1-2-24(18-10-4-3-5-11-18)21(26)19(22(27)28)14-20(25)23-13-12-16-8-6-7-9-17(16)15-23/h3-11,19H,2,12-15H2,1H3,(H,27,28) |
| InChIKey | GABYVSBMDKJTEQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|