About 5-[(5-methylfuran-2-yl)methylcarbamoylamino]-3-pentylsulfanyl-1,2-thiazole-4-carboxamide
5-[(5-methylfuran-2-yl)methylcarbamoylamino]-3-pentylsulfanyl-1,2-thiazole-4-carboxamide (PubChem CID 68510966) has the molecular formula C16H22N4O3S2
and a molecular weight of 382.51 g/mol. Its IUPAC name is 5-[(5-methylfuran-2-yl)methylcarbamoylamino]-3-pentylsulfanyl-1,2-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | 5-[(5-methylfuran-2-yl)methylcarbamoylamino]-3-pentylsulfanyl-1,2-thiazole-4-carboxamide |
| PubChem CID | 68510966 |
| Molecular Formula | C16H22N4O3S2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 5-[(5-methylfuran-2-yl)methylcarbamoylamino]-3-pentylsulfanyl-1,2-thiazole-4-carboxamide |
| SMILES | CCCCCSc1nsc(NC(=O)NCc2ccc(C)o2)c1C(N)=O |
| InChI | InChI=1S/C16H22N4O3S2/c1-3-4-5-8-24-15-12(13(17)21)14(25-20-15)19-16(22)18-9-11-7-6-10(2)23-11/h6-7H,3-5,8-9H2,1-2H3,(H2,17,21)(H2,18,19,22) |
| InChIKey | FZBQENYVKVLUGK-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 110.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[(5-methylfuran-2-yl)methylcarbamoylamino]-3-pentylsulfanyl-1,2-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(5-methylfuran-2-yl)methylcarbamoylamino]-3-pentylsulfanyl-1,2-thiazole-4-carboxamide?
The IUPAC name of 5-[(5-methylfuran-2-yl)methylcarbamoylamino]-3-pentylsulfanyl-1,2-thiazole-4-carboxamide (CID 68510966) is 5-[(5-methylfuran-2-yl)methylcarbamoylamino]-3-pentylsulfanyl-1,2-thiazole-4-carboxamide.
What is the SMILES notation for 5-[(5-methylfuran-2-yl)methylcarbamoylamino]-3-pentylsulfanyl-1,2-thiazole-4-carboxamide?
The canonical SMILES for 5-[(5-methylfuran-2-yl)methylcarbamoylamino]-3-pentylsulfanyl-1,2-thiazole-4-carboxamide is CCCCCSc1nsc(NC(=O)NCc2ccc(C)o2)c1C(N)=O.
What is the InChIKey of 5-[(5-methylfuran-2-yl)methylcarbamoylamino]-3-pentylsulfanyl-1,2-thiazole-4-carboxamide?
The InChIKey is FZBQENYVKVLUGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N4O3S2/c1-3-4-5-8-24-15-12(13(17)21)14(25-20-15)19-16(22)18-9-11-7-6-10(2)23-11/h6-7H,3-5,8-9H2,1-2H3,(H2,17,21)(H2,18,19,22).
What are the key properties of 5-[(5-methylfuran-2-yl)methylcarbamoylamino]-3-pentylsulfanyl-1,2-thiazole-4-carboxamide?
5-[(5-methylfuran-2-yl)methylcarbamoylamino]-3-pentylsulfanyl-1,2-thiazole-4-carboxamide has a molecular weight of 382.51 g/mol, XLogP of 3.75, 9 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(5-methylfuran-2-yl)methylcarbamoylamino]-3-pentylsulfanyl-1,2-thiazole-4-carboxamide is sourced from PubChem (CID 68510966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).