About 4-(4-amino-3-chlorophenyl)sulfanyl-2-chloroaniline;3-(3-aminophenyl)sulfonylaniline
4-(4-amino-3-chlorophenyl)sulfanyl-2-chloroaniline;3-(3-aminophenyl)sulfonylaniline (PubChem CID 68511209) has the molecular formula C24H22Cl2N4O2S2
and a molecular weight of 533.51 g/mol. Its IUPAC name is 4-(4-amino-3-chlorophenyl)sulfanyl-2-chloroaniline;3-(3-aminophenyl)sulfonylaniline.
Molecular Properties
| Compound Name | 4-(4-amino-3-chlorophenyl)sulfanyl-2-chloroaniline;3-(3-aminophenyl)sulfonylaniline |
| PubChem CID | 68511209 |
| Molecular Formula | C24H22Cl2N4O2S2 |
| Molecular Weight | 533.51 g/mol |
| Exact Mass | 532.06 |
| IUPAC Name | 4-(4-amino-3-chlorophenyl)sulfanyl-2-chloroaniline;3-(3-aminophenyl)sulfonylaniline |
| SMILES | Nc1ccc(Sc2ccc(N)c(Cl)c2)cc1Cl.Nc1cccc(S(=O)(=O)c2cccc(N)c2)c1 |
| InChI | InChI=1S/C12H10Cl2N2S.C12H12N2O2S/c13-9-5-7(1-3-11(9)15)17-8-2-4-12(16)10(14)6-8;13-9-3-1-5-11(7-9)17(15,16)12-6-2-4-10(14)8-12/h1-6H,15-16H2;1-8H,13-14H2 |
| InChIKey | BIPVWUGBFASGRL-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 138.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 533.51 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-amino-3-chlorophenyl)sulfanyl-2-chloroaniline;3-(3-aminophenyl)sulfonylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-amino-3-chlorophenyl)sulfanyl-2-chloroaniline;3-(3-aminophenyl)sulfonylaniline?
The IUPAC name of 4-(4-amino-3-chlorophenyl)sulfanyl-2-chloroaniline;3-(3-aminophenyl)sulfonylaniline (CID 68511209) is 4-(4-amino-3-chlorophenyl)sulfanyl-2-chloroaniline;3-(3-aminophenyl)sulfonylaniline.
What is the SMILES notation for 4-(4-amino-3-chlorophenyl)sulfanyl-2-chloroaniline;3-(3-aminophenyl)sulfonylaniline?
The canonical SMILES for 4-(4-amino-3-chlorophenyl)sulfanyl-2-chloroaniline;3-(3-aminophenyl)sulfonylaniline is Nc1ccc(Sc2ccc(N)c(Cl)c2)cc1Cl.Nc1cccc(S(=O)(=O)c2cccc(N)c2)c1.
What is the InChIKey of 4-(4-amino-3-chlorophenyl)sulfanyl-2-chloroaniline;3-(3-aminophenyl)sulfonylaniline?
The InChIKey is BIPVWUGBFASGRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10Cl2N2S.C12H12N2O2S/c13-9-5-7(1-3-11(9)15)17-8-2-4-12(16)10(14)6-8;13-9-3-1-5-11(7-9)17(15,16)12-6-2-4-10(14)8-12/h1-6H,15-16H2;1-8H,13-14H2.
What are the key properties of 4-(4-amino-3-chlorophenyl)sulfanyl-2-chloroaniline;3-(3-aminophenyl)sulfonylaniline?
4-(4-amino-3-chlorophenyl)sulfanyl-2-chloroaniline;3-(3-aminophenyl)sulfonylaniline has a molecular weight of 533.51 g/mol, XLogP of 5.99, 4 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-amino-3-chlorophenyl)sulfanyl-2-chloroaniline;3-(3-aminophenyl)sulfonylaniline is sourced from PubChem (CID 68511209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).