C13H32OSi3 — CID 68511371
6-butyl-2,2,3,3,4,4,6-heptamethyloxatrisilinane (PubChem CID 68511371) has the molecular formula C13H32OSi3 and a molecular weight of 288.66 g/mol. Its IUPAC name is 6-butyl-2,2,3,3,4,4,6-heptamethyloxatrisilinane.
| Compound Name | 6-butyl-2,2,3,3,4,4,6-heptamethyloxatrisilinane |
|---|---|
| PubChem CID | 68511371 |
| Molecular Formula | C13H32OSi3 |
| Molecular Weight | 288.66 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 6-butyl-2,2,3,3,4,4,6-heptamethyloxatrisilinane |
| SMILES | CCCCC1(C)C[Si](C)(C)[Si](C)(C)[Si](C)(C)O1 |
| InChI | InChI=1S/C13H32OSi3/c1-9-10-11-13(2)12-15(3,4)17(7,8)16(5,6)14-13/h9-12H2,1-8H3 |
| InChIKey | CJSRIWMZQWLEHT-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.66 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|