C18H15Cl2FN2O3 — CID 68511800
(Z)-1-(5,8-dichloro-6,7-dihydroxy-3,4-dihydro-1H-isoquinolin-2-yl)-3-(5-fluoro-2-pyridinyl)but-2-en-1-one (PubChem CID 68511800) has the molecular formula C18H15Cl2FN2O3 and a molecular weight of 397.23 g/mol. Its IUPAC name is (Z)-1-(5,8-dichloro-6,7-dihydroxy-3,4-dihydro-1H-isoquinolin-2-yl)-3-(5-fluoro-2-pyridinyl)but-2-en-1-one.
| Compound Name | (Z)-1-(5,8-dichloro-6,7-dihydroxy-3,4-dihydro-1H-isoquinolin-2-yl)-3-(5-fluoro-2-pyridinyl)but-2-en-1-one |
|---|---|
| PubChem CID | 68511800 |
| Molecular Formula | C18H15Cl2FN2O3 |
| Molecular Weight | 397.23 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | (Z)-1-(5,8-dichloro-6,7-dihydroxy-3,4-dihydro-1H-isoquinolin-2-yl)-3-(5-fluoro-2-pyridinyl)but-2-en-1-one |
| SMILES | C/C(=C/C(=O)N1CCc2c(Cl)c(O)c(O)c(Cl)c2C1)c1ccc(F)cn1 |
| InChI | InChI=1S/C18H15Cl2FN2O3/c1-9(13-3-2-10(21)7-22-13)6-14(24)23-5-4-11-12(8-23)16(20)18(26)17(25)15(11)19/h2-3,6-7,25-26H,4-5,8H2,1H3/b9-6- |
| InChIKey | LNARCSLUZHRKJN-TWGQIWQCSA-N |
| XLogP | 3.93 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.23 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|