C23H22Cl2F3N3O3 — CID 68511816
1-(5,8-dichloro-6,7-dihydroxy-3,4-dihydro-1H-isoquinolin-2-yl)-3-[2-piperidin-1-yl-6-(trifluoromethyl)-3-pyridinyl]prop-2-en-1-one (PubChem CID 68511816) has the molecular formula C23H22Cl2F3N3O3 and a molecular weight of 516.35 g/mol. Its IUPAC name is 1-(5,8-dichloro-6,7-dihydroxy-3,4-dihydro-1H-isoquinolin-2-yl)-3-[2-piperidin-1-yl-6-(trifluoromethyl)-3-pyridinyl]prop-2-en-1-one.
| Compound Name | 1-(5,8-dichloro-6,7-dihydroxy-3,4-dihydro-1H-isoquinolin-2-yl)-3-[2-piperidin-1-yl-6-(trifluoromethyl)-3-pyridinyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 68511816 |
| Molecular Formula | C23H22Cl2F3N3O3 |
| Molecular Weight | 516.35 g/mol |
| Exact Mass | 515.10 |
| IUPAC Name | 1-(5,8-dichloro-6,7-dihydroxy-3,4-dihydro-1H-isoquinolin-2-yl)-3-[2-piperidin-1-yl-6-(trifluoromethyl)-3-pyridinyl]prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccc(C(F)(F)F)nc1N1CCCCC1)N1CCc2c(Cl)c(O)c(O)c(Cl)c2C1 |
| InChI | InChI=1S/C23H22Cl2F3N3O3/c24-18-14-8-11-31(12-15(14)19(25)21(34)20(18)33)17(32)7-5-13-4-6-16(23(26,27)28)29-22(13)30-9-2-1-3-10-30/h4-7,33-34H,1-3,8-12H2 |
| InChIKey | CFWWDZSBDPEZII-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 76.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.35 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|