C21H25BrN2O3S — CID 68513096
2-(3-bromo-8-ethylquinolin-6-yl)oxy-N-(5-methoxy-2-methylpent-3-yn-2-yl)-2-methylsulfanylacetamide (PubChem CID 68513096) has the molecular formula C21H25BrN2O3S and a molecular weight of 465.41 g/mol. Its IUPAC name is 2-(3-bromo-8-ethylquinolin-6-yl)oxy-N-(5-methoxy-2-methylpent-3-yn-2-yl)-2-methylsulfanylacetamide.
| Compound Name | 2-(3-bromo-8-ethylquinolin-6-yl)oxy-N-(5-methoxy-2-methylpent-3-yn-2-yl)-2-methylsulfanylacetamide |
|---|---|
| PubChem CID | 68513096 |
| Molecular Formula | C21H25BrN2O3S |
| Molecular Weight | 465.41 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | 2-(3-bromo-8-ethylquinolin-6-yl)oxy-N-(5-methoxy-2-methylpent-3-yn-2-yl)-2-methylsulfanylacetamide |
| SMILES | CCc1cc(OC(SC)C(=O)NC(C)(C)C#CCOC)cc2cc(Br)cnc12 |
| InChI | InChI=1S/C21H25BrN2O3S/c1-6-14-11-17(12-15-10-16(22)13-23-18(14)15)27-20(28-5)19(25)24-21(2,3)8-7-9-26-4/h10-13,20H,6,9H2,1-5H3,(H,24,25) |
| InChIKey | GDGXRUPPGHJFSC-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|