About piperidin-3-yl butanoate
piperidin-3-yl butanoate (PubChem CID 68513166) has the molecular formula C9H17NO2
and a molecular weight of 171.24 g/mol. Its IUPAC name is piperidin-3-yl butanoate.
Molecular Properties
| Compound Name | piperidin-3-yl butanoate |
| PubChem CID | 68513166 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | piperidin-3-yl butanoate |
| SMILES | CCCC(=O)OC1CCCNC1 |
| InChI | InChI=1S/C9H17NO2/c1-2-4-9(11)12-8-5-3-6-10-7-8/h8,10H,2-7H2,1H3 |
| InChIKey | GIXGUXIGNVUACV-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze piperidin-3-yl butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidin-3-yl butanoate?
The IUPAC name of piperidin-3-yl butanoate (CID 68513166) is piperidin-3-yl butanoate.
What is the SMILES notation for piperidin-3-yl butanoate?
The canonical SMILES for piperidin-3-yl butanoate is CCCC(=O)OC1CCCNC1.
What is the InChIKey of piperidin-3-yl butanoate?
The InChIKey is GIXGUXIGNVUACV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2/c1-2-4-9(11)12-8-5-3-6-10-7-8/h8,10H,2-7H2,1H3.
What are the key properties of piperidin-3-yl butanoate?
piperidin-3-yl butanoate has a molecular weight of 171.24 g/mol, XLogP of 1.08, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-3-yl butanoate is sourced from PubChem (CID 68513166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).