About 3-[2-(2,4-dichlorobenzoyl)-3-propan-2-yl-1-benzofuran-6-yl]benzonitrile
3-[2-(2,4-dichlorobenzoyl)-3-propan-2-yl-1-benzofuran-6-yl]benzonitrile (PubChem CID 68513579) has the molecular formula C25H17Cl2NO2
and a molecular weight of 434.32 g/mol. Its IUPAC name is 3-[2-(2,4-dichlorobenzoyl)-3-propan-2-yl-1-benzofuran-6-yl]benzonitrile.
Molecular Properties
| Compound Name | 3-[2-(2,4-dichlorobenzoyl)-3-propan-2-yl-1-benzofuran-6-yl]benzonitrile |
| PubChem CID | 68513579 |
| Molecular Formula | C25H17Cl2NO2 |
| Molecular Weight | 434.32 g/mol |
| Exact Mass | 433.06 |
| IUPAC Name | 3-[2-(2,4-dichlorobenzoyl)-3-propan-2-yl-1-benzofuran-6-yl]benzonitrile |
| SMILES | CC(C)c1c(C(=O)c2ccc(Cl)cc2Cl)oc2cc(-c3cccc(C#N)c3)ccc12 |
| InChI | InChI=1S/C25H17Cl2NO2/c1-14(2)23-20-8-6-17(16-5-3-4-15(10-16)13-28)11-22(20)30-25(23)24(29)19-9-7-18(26)12-21(19)27/h3-12,14H,1-2H3 |
| InChIKey | PHEYUAAIPVBDCV-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 54.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.32 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[2-(2,4-dichlorobenzoyl)-3-propan-2-yl-1-benzofuran-6-yl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(2,4-dichlorobenzoyl)-3-propan-2-yl-1-benzofuran-6-yl]benzonitrile?
The IUPAC name of 3-[2-(2,4-dichlorobenzoyl)-3-propan-2-yl-1-benzofuran-6-yl]benzonitrile (CID 68513579) is 3-[2-(2,4-dichlorobenzoyl)-3-propan-2-yl-1-benzofuran-6-yl]benzonitrile.
What is the SMILES notation for 3-[2-(2,4-dichlorobenzoyl)-3-propan-2-yl-1-benzofuran-6-yl]benzonitrile?
The canonical SMILES for 3-[2-(2,4-dichlorobenzoyl)-3-propan-2-yl-1-benzofuran-6-yl]benzonitrile is CC(C)c1c(C(=O)c2ccc(Cl)cc2Cl)oc2cc(-c3cccc(C#N)c3)ccc12.
What is the InChIKey of 3-[2-(2,4-dichlorobenzoyl)-3-propan-2-yl-1-benzofuran-6-yl]benzonitrile?
The InChIKey is PHEYUAAIPVBDCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H17Cl2NO2/c1-14(2)23-20-8-6-17(16-5-3-4-15(10-16)13-28)11-22(20)30-25(23)24(29)19-9-7-18(26)12-21(19)27/h3-12,14H,1-2H3.
What are the key properties of 3-[2-(2,4-dichlorobenzoyl)-3-propan-2-yl-1-benzofuran-6-yl]benzonitrile?
3-[2-(2,4-dichlorobenzoyl)-3-propan-2-yl-1-benzofuran-6-yl]benzonitrile has a molecular weight of 434.32 g/mol, XLogP of 7.63, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(2,4-dichlorobenzoyl)-3-propan-2-yl-1-benzofuran-6-yl]benzonitrile is sourced from PubChem (CID 68513579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).