C33H34ClFN4O4 — CID 68513635
[4-[1-[4-(aminomethyl)-2-fluorobenzoyl]piperidin-3-yl]-4-(3-chloro-2-quinolin-3-ylphenyl)-4-hydroxybutyl]carbamic acid (PubChem CID 68513635) has the molecular formula C33H34ClFN4O4 and a molecular weight of 605.11 g/mol. Its IUPAC name is [4-[1-[4-(aminomethyl)-2-fluorobenzoyl]piperidin-3-yl]-4-(3-chloro-2-quinolin-3-ylphenyl)-4-hydroxybutyl]carbamic acid.
| Compound Name | [4-[1-[4-(aminomethyl)-2-fluorobenzoyl]piperidin-3-yl]-4-(3-chloro-2-quinolin-3-ylphenyl)-4-hydroxybutyl]carbamic acid |
|---|---|
| PubChem CID | 68513635 |
| Molecular Formula | C33H34ClFN4O4 |
| Molecular Weight | 605.11 g/mol |
| Exact Mass | 604.23 |
| IUPAC Name | [4-[1-[4-(aminomethyl)-2-fluorobenzoyl]piperidin-3-yl]-4-(3-chloro-2-quinolin-3-ylphenyl)-4-hydroxybutyl]carbamic acid |
| SMILES | NCc1ccc(C(=O)N2CCCC(C(O)(CCCNC(=O)O)c3cccc(Cl)c3-c3cnc4ccccc4c3)C2)c(F)c1 |
| InChI | InChI=1S/C33H34ClFN4O4/c34-27-9-3-8-26(30(27)23-17-22-6-1-2-10-29(22)38-19-23)33(43,13-5-14-37-32(41)42)24-7-4-15-39(20-24)31(40)25-12-11-21(18-36)16-28(25)35/h1-3,6,8-12,16-17,19,24,37,43H,4-5,7,13-15,18,20,36H2,(H,41,42) |
| InChIKey | BHVFVTDBBVLLCL-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 128.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.11 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|