About 6H-1,4-benzodiazepin-7-amine
6H-1,4-benzodiazepin-7-amine (PubChem CID 68513910) has the molecular formula C9H9N3
and a molecular weight of 159.19 g/mol. Its IUPAC name is 6H-1,4-benzodiazepin-7-amine.
Molecular Properties
| Compound Name | 6H-1,4-benzodiazepin-7-amine |
| PubChem CID | 68513910 |
| Molecular Formula | C9H9N3 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | 6H-1,4-benzodiazepin-7-amine |
| SMILES | NC1=CC=C2N=CC=NC=C2C1 |
| InChI | InChI=1S/C9H9N3/c10-8-1-2-9-7(5-8)6-11-3-4-12-9/h1-4,6H,5,10H2 |
| InChIKey | OKNKVKVPRLRQAV-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6H-1,4-benzodiazepin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6H-1,4-benzodiazepin-7-amine?
The IUPAC name of 6H-1,4-benzodiazepin-7-amine (CID 68513910) is 6H-1,4-benzodiazepin-7-amine.
What is the SMILES notation for 6H-1,4-benzodiazepin-7-amine?
The canonical SMILES for 6H-1,4-benzodiazepin-7-amine is NC1=CC=C2N=CC=NC=C2C1.
What is the InChIKey of 6H-1,4-benzodiazepin-7-amine?
The InChIKey is OKNKVKVPRLRQAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3/c10-8-1-2-9-7(5-8)6-11-3-4-12-9/h1-4,6H,5,10H2.
What are the key properties of 6H-1,4-benzodiazepin-7-amine?
6H-1,4-benzodiazepin-7-amine has a molecular weight of 159.19 g/mol, XLogP of 1.16, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6H-1,4-benzodiazepin-7-amine is sourced from PubChem (CID 68513910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).