C22H22Cl2FN3O4S — CID 68514128
[2-[6-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-1,3-benzothiazol-2-yl]-2-morpholin-4-ylethyl] carbamate (PubChem CID 68514128) has the molecular formula C22H22Cl2FN3O4S and a molecular weight of 514.41 g/mol. Its IUPAC name is [2-[6-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-1,3-benzothiazol-2-yl]-2-morpholin-4-ylethyl] carbamate.
| Compound Name | [2-[6-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-1,3-benzothiazol-2-yl]-2-morpholin-4-ylethyl] carbamate |
|---|---|
| PubChem CID | 68514128 |
| Molecular Formula | C22H22Cl2FN3O4S |
| Molecular Weight | 514.41 g/mol |
| Exact Mass | 513.07 |
| IUPAC Name | [2-[6-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-1,3-benzothiazol-2-yl]-2-morpholin-4-ylethyl] carbamate |
| SMILES | CC(Oc1ccc2nc(C(COC(N)=O)N3CCOCC3)sc2c1)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C22H22Cl2FN3O4S/c1-12(19-14(23)3-4-15(25)20(19)24)32-13-2-5-16-18(10-13)33-21(27-16)17(11-31-22(26)29)28-6-8-30-9-7-28/h2-5,10,12,17H,6-9,11H2,1H3,(H2,26,29) |
| InChIKey | XODYXMSCQUBWOD-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 86.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.41 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|