About 1,6-dihydroimidazo[4,5-d]azepine
1,6-dihydroimidazo[4,5-d]azepine (PubChem CID 68514643) has the molecular formula C7H7N3
and a molecular weight of 133.15 g/mol. Its IUPAC name is 1,6-dihydroimidazo[4,5-d]azepine.
Molecular Properties
| Compound Name | 1,6-dihydroimidazo[4,5-d]azepine |
| PubChem CID | 68514643 |
| Molecular Formula | C7H7N3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.06 |
| IUPAC Name | 1,6-dihydroimidazo[4,5-d]azepine |
| SMILES | C1=Cc2nc[nH]c2C=CN1 |
| InChI | InChI=1S/C7H7N3/c1-3-8-4-2-7-6(1)9-5-10-7/h1-5,8H,(H,9,10) |
| InChIKey | GLNIIYRLENHXHW-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,6-dihydroimidazo[4,5-d]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-dihydroimidazo[4,5-d]azepine?
The IUPAC name of 1,6-dihydroimidazo[4,5-d]azepine (CID 68514643) is 1,6-dihydroimidazo[4,5-d]azepine.
What is the SMILES notation for 1,6-dihydroimidazo[4,5-d]azepine?
The canonical SMILES for 1,6-dihydroimidazo[4,5-d]azepine is C1=Cc2nc[nH]c2C=CN1.
What is the InChIKey of 1,6-dihydroimidazo[4,5-d]azepine?
The InChIKey is GLNIIYRLENHXHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3/c1-3-8-4-2-7-6(1)9-5-10-7/h1-5,8H,(H,9,10).
What are the key properties of 1,6-dihydroimidazo[4,5-d]azepine?
1,6-dihydroimidazo[4,5-d]azepine has a molecular weight of 133.15 g/mol, XLogP of 0.95, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-dihydroimidazo[4,5-d]azepine is sourced from PubChem (CID 68514643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).