About 2-bromo-5-pentyl-1,3-thiazole-4-carboxylic acid
2-bromo-5-pentyl-1,3-thiazole-4-carboxylic acid (PubChem CID 68515406) has the molecular formula C9H12BrNO2S
and a molecular weight of 278.17 g/mol. Its IUPAC name is 2-bromo-5-pentyl-1,3-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-bromo-5-pentyl-1,3-thiazole-4-carboxylic acid |
| PubChem CID | 68515406 |
| Molecular Formula | C9H12BrNO2S |
| Molecular Weight | 278.17 g/mol |
| Exact Mass | 276.98 |
| IUPAC Name | 2-bromo-5-pentyl-1,3-thiazole-4-carboxylic acid |
| SMILES | CCCCCc1sc(Br)nc1C(=O)O |
| InChI | InChI=1S/C9H12BrNO2S/c1-2-3-4-5-6-7(8(12)13)11-9(10)14-6/h2-5H2,1H3,(H,12,13) |
| InChIKey | FBJKZKLUSGNYIQ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.17 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-5-pentyl-1,3-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5-pentyl-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 2-bromo-5-pentyl-1,3-thiazole-4-carboxylic acid (CID 68515406) is 2-bromo-5-pentyl-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 2-bromo-5-pentyl-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 2-bromo-5-pentyl-1,3-thiazole-4-carboxylic acid is CCCCCc1sc(Br)nc1C(=O)O.
What is the InChIKey of 2-bromo-5-pentyl-1,3-thiazole-4-carboxylic acid?
The InChIKey is FBJKZKLUSGNYIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12BrNO2S/c1-2-3-4-5-6-7(8(12)13)11-9(10)14-6/h2-5H2,1H3,(H,12,13).
What are the key properties of 2-bromo-5-pentyl-1,3-thiazole-4-carboxylic acid?
2-bromo-5-pentyl-1,3-thiazole-4-carboxylic acid has a molecular weight of 278.17 g/mol, XLogP of 3.34, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5-pentyl-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 68515406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).