C17H21BrF3NO — CID 68515894
1-(4-bromo-3-methylphenyl)-3-[di(propan-2-yl)amino]-4,4,4-trifluorobut-2-en-1-one (PubChem CID 68515894) has the molecular formula C17H21BrF3NO and a molecular weight of 392.26 g/mol. Its IUPAC name is 1-(4-bromo-3-methylphenyl)-3-[di(propan-2-yl)amino]-4,4,4-trifluorobut-2-en-1-one.
| Compound Name | 1-(4-bromo-3-methylphenyl)-3-[di(propan-2-yl)amino]-4,4,4-trifluorobut-2-en-1-one |
|---|---|
| PubChem CID | 68515894 |
| Molecular Formula | C17H21BrF3NO |
| Molecular Weight | 392.26 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | 1-(4-bromo-3-methylphenyl)-3-[di(propan-2-yl)amino]-4,4,4-trifluorobut-2-en-1-one |
| SMILES | Cc1cc(C(=O)C=C(N(C(C)C)C(C)C)C(F)(F)F)ccc1Br |
| InChI | InChI=1S/C17H21BrF3NO/c1-10(2)22(11(3)4)16(17(19,20)21)9-15(23)13-6-7-14(18)12(5)8-13/h6-11H,1-5H3 |
| InChIKey | HLEZWMIMPTUQBD-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.26 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|