About 4-chloro-N-[(3R,4R)-3-fluoropiperidin-4-yl]-5-methyl-1H-pyrrole-2-carboxamide
4-chloro-N-[(3R,4R)-3-fluoropiperidin-4-yl]-5-methyl-1H-pyrrole-2-carboxamide (PubChem CID 68515913) has the molecular formula C11H15ClFN3O
and a molecular weight of 259.71 g/mol. Its IUPAC name is 4-chloro-N-[(3R,4R)-3-fluoropiperidin-4-yl]-5-methyl-1H-pyrrole-2-carboxamide.
Molecular Properties
| Compound Name | 4-chloro-N-[(3R,4R)-3-fluoropiperidin-4-yl]-5-methyl-1H-pyrrole-2-carboxamide |
| PubChem CID | 68515913 |
| Molecular Formula | C11H15ClFN3O |
| Molecular Weight | 259.71 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 4-chloro-N-[(3R,4R)-3-fluoropiperidin-4-yl]-5-methyl-1H-pyrrole-2-carboxamide |
| SMILES | Cc1[nH]c(C(=O)N[C@@H]2CCNC[C@H]2F)cc1Cl |
| InChI | InChI=1S/C11H15ClFN3O/c1-6-7(12)4-10(15-6)11(17)16-9-2-3-14-5-8(9)13/h4,8-9,14-15H,2-3,5H2,1H3,(H,16,17)/t8-,9-/m1/s1 |
| InChIKey | GZDVXHBWAQUGAW-RKDXNWHRSA-N |
| XLogP | 1.41 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.71 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-chloro-N-[(3R,4R)-3-fluoropiperidin-4-yl]-5-methyl-1H-pyrrole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-[(3R,4R)-3-fluoropiperidin-4-yl]-5-methyl-1H-pyrrole-2-carboxamide?
The IUPAC name of 4-chloro-N-[(3R,4R)-3-fluoropiperidin-4-yl]-5-methyl-1H-pyrrole-2-carboxamide (CID 68515913) is 4-chloro-N-[(3R,4R)-3-fluoropiperidin-4-yl]-5-methyl-1H-pyrrole-2-carboxamide.
What is the SMILES notation for 4-chloro-N-[(3R,4R)-3-fluoropiperidin-4-yl]-5-methyl-1H-pyrrole-2-carboxamide?
The canonical SMILES for 4-chloro-N-[(3R,4R)-3-fluoropiperidin-4-yl]-5-methyl-1H-pyrrole-2-carboxamide is Cc1[nH]c(C(=O)N[C@@H]2CCNC[C@H]2F)cc1Cl.
What is the InChIKey of 4-chloro-N-[(3R,4R)-3-fluoropiperidin-4-yl]-5-methyl-1H-pyrrole-2-carboxamide?
The InChIKey is GZDVXHBWAQUGAW-RKDXNWHRSA-N. The full InChI is InChI=1S/C11H15ClFN3O/c1-6-7(12)4-10(15-6)11(17)16-9-2-3-14-5-8(9)13/h4,8-9,14-15H,2-3,5H2,1H3,(H,16,17)/t8-,9-/m1/s1.
What are the key properties of 4-chloro-N-[(3R,4R)-3-fluoropiperidin-4-yl]-5-methyl-1H-pyrrole-2-carboxamide?
4-chloro-N-[(3R,4R)-3-fluoropiperidin-4-yl]-5-methyl-1H-pyrrole-2-carboxamide has a molecular weight of 259.71 g/mol, XLogP of 1.41, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-[(3R,4R)-3-fluoropiperidin-4-yl]-5-methyl-1H-pyrrole-2-carboxamide is sourced from PubChem (CID 68515913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).