C34H37FN4O4 — CID 68516037
[4-(3-fluoro-2-quinolin-3-ylphenyl)-4-hydroxy-4-[1-[4-(methylaminomethyl)benzoyl]piperidin-3-yl]butyl]carbamic acid (PubChem CID 68516037) has the molecular formula C34H37FN4O4 and a molecular weight of 584.69 g/mol. Its IUPAC name is [4-(3-fluoro-2-quinolin-3-ylphenyl)-4-hydroxy-4-[1-[4-(methylaminomethyl)benzoyl]piperidin-3-yl]butyl]carbamic acid.
| Compound Name | [4-(3-fluoro-2-quinolin-3-ylphenyl)-4-hydroxy-4-[1-[4-(methylaminomethyl)benzoyl]piperidin-3-yl]butyl]carbamic acid |
|---|---|
| PubChem CID | 68516037 |
| Molecular Formula | C34H37FN4O4 |
| Molecular Weight | 584.69 g/mol |
| Exact Mass | 584.28 |
| IUPAC Name | [4-(3-fluoro-2-quinolin-3-ylphenyl)-4-hydroxy-4-[1-[4-(methylaminomethyl)benzoyl]piperidin-3-yl]butyl]carbamic acid |
| SMILES | CNCc1ccc(C(=O)N2CCCC(C(O)(CCCNC(=O)O)c3cccc(F)c3-c3cnc4ccccc4c3)C2)cc1 |
| InChI | InChI=1S/C34H37FN4O4/c1-36-20-23-12-14-24(15-13-23)32(40)39-18-5-8-27(22-39)34(43,16-6-17-37-33(41)42)28-9-4-10-29(35)31(28)26-19-25-7-2-3-11-30(25)38-21-26/h2-4,7,9-15,19,21,27,36-37,43H,5-6,8,16-18,20,22H2,1H3,(H,41,42) |
| InChIKey | HQFQQVQMFISGOA-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 114.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.69 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|