About 3-morpholin-4-yl-1H-1,2,4-triazole-5-carboxamide
3-morpholin-4-yl-1H-1,2,4-triazole-5-carboxamide (PubChem CID 68516048) has the molecular formula C7H11N5O2
and a molecular weight of 197.20 g/mol. Its IUPAC name is 3-morpholin-4-yl-1H-1,2,4-triazole-5-carboxamide.
Molecular Properties
| Compound Name | 3-morpholin-4-yl-1H-1,2,4-triazole-5-carboxamide |
| PubChem CID | 68516048 |
| Molecular Formula | C7H11N5O2 |
| Molecular Weight | 197.20 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | 3-morpholin-4-yl-1H-1,2,4-triazole-5-carboxamide |
| SMILES | NC(=O)c1nc(N2CCOCC2)n[nH]1 |
| InChI | InChI=1S/C7H11N5O2/c8-5(13)6-9-7(11-10-6)12-1-3-14-4-2-12/h1-4H2,(H2,8,13)(H,9,10,11) |
| InChIKey | NTOXVTTXIRDZBK-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 97.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.20 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-morpholin-4-yl-1H-1,2,4-triazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-morpholin-4-yl-1H-1,2,4-triazole-5-carboxamide?
The IUPAC name of 3-morpholin-4-yl-1H-1,2,4-triazole-5-carboxamide (CID 68516048) is 3-morpholin-4-yl-1H-1,2,4-triazole-5-carboxamide.
What is the SMILES notation for 3-morpholin-4-yl-1H-1,2,4-triazole-5-carboxamide?
The canonical SMILES for 3-morpholin-4-yl-1H-1,2,4-triazole-5-carboxamide is NC(=O)c1nc(N2CCOCC2)n[nH]1.
What is the InChIKey of 3-morpholin-4-yl-1H-1,2,4-triazole-5-carboxamide?
The InChIKey is NTOXVTTXIRDZBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N5O2/c8-5(13)6-9-7(11-10-6)12-1-3-14-4-2-12/h1-4H2,(H2,8,13)(H,9,10,11).
What are the key properties of 3-morpholin-4-yl-1H-1,2,4-triazole-5-carboxamide?
3-morpholin-4-yl-1H-1,2,4-triazole-5-carboxamide has a molecular weight of 197.20 g/mol, XLogP of -1.26, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-morpholin-4-yl-1H-1,2,4-triazole-5-carboxamide is sourced from PubChem (CID 68516048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).