About 2-[4-(4-amino-2-fluorophenoxy)-2H-pyrazolo[3,4-b]pyridin-3-yl]ethanol
2-[4-(4-amino-2-fluorophenoxy)-2H-pyrazolo[3,4-b]pyridin-3-yl]ethanol (PubChem CID 68516164) has the molecular formula C14H13FN4O2
and a molecular weight of 288.28 g/mol. Its IUPAC name is 2-[4-(4-amino-2-fluorophenoxy)-2H-pyrazolo[3,4-b]pyridin-3-yl]ethanol.
Molecular Properties
| Compound Name | 2-[4-(4-amino-2-fluorophenoxy)-2H-pyrazolo[3,4-b]pyridin-3-yl]ethanol |
| PubChem CID | 68516164 |
| Molecular Formula | C14H13FN4O2 |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 2-[4-(4-amino-2-fluorophenoxy)-2H-pyrazolo[3,4-b]pyridin-3-yl]ethanol |
| SMILES | Nc1ccc(Oc2ccnc3n[nH]c(CCO)c23)c(F)c1 |
| InChI | InChI=1S/C14H13FN4O2/c15-9-7-8(16)1-2-11(9)21-12-3-5-17-14-13(12)10(4-6-20)18-19-14/h1-3,5,7,20H,4,6,16H2,(H,17,18,19) |
| InChIKey | UQCFDESQRYKBMB-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(4-amino-2-fluorophenoxy)-2H-pyrazolo[3,4-b]pyridin-3-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(4-amino-2-fluorophenoxy)-2H-pyrazolo[3,4-b]pyridin-3-yl]ethanol?
The IUPAC name of 2-[4-(4-amino-2-fluorophenoxy)-2H-pyrazolo[3,4-b]pyridin-3-yl]ethanol (CID 68516164) is 2-[4-(4-amino-2-fluorophenoxy)-2H-pyrazolo[3,4-b]pyridin-3-yl]ethanol.
What is the SMILES notation for 2-[4-(4-amino-2-fluorophenoxy)-2H-pyrazolo[3,4-b]pyridin-3-yl]ethanol?
The canonical SMILES for 2-[4-(4-amino-2-fluorophenoxy)-2H-pyrazolo[3,4-b]pyridin-3-yl]ethanol is Nc1ccc(Oc2ccnc3n[nH]c(CCO)c23)c(F)c1.
What is the InChIKey of 2-[4-(4-amino-2-fluorophenoxy)-2H-pyrazolo[3,4-b]pyridin-3-yl]ethanol?
The InChIKey is UQCFDESQRYKBMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13FN4O2/c15-9-7-8(16)1-2-11(9)21-12-3-5-17-14-13(12)10(4-6-20)18-19-14/h1-3,5,7,20H,4,6,16H2,(H,17,18,19).
What are the key properties of 2-[4-(4-amino-2-fluorophenoxy)-2H-pyrazolo[3,4-b]pyridin-3-yl]ethanol?
2-[4-(4-amino-2-fluorophenoxy)-2H-pyrazolo[3,4-b]pyridin-3-yl]ethanol has a molecular weight of 288.28 g/mol, XLogP of 2.01, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(4-amino-2-fluorophenoxy)-2H-pyrazolo[3,4-b]pyridin-3-yl]ethanol is sourced from PubChem (CID 68516164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).