C21H26F2N2O6 — CID 68516268
benzyl 4-(3,3-difluoro-2,6-dioxopiperidin-1-yl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 68516268) has the molecular formula C21H26F2N2O6 and a molecular weight of 440.44 g/mol. Its IUPAC name is benzyl 4-(3,3-difluoro-2,6-dioxopiperidin-1-yl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | benzyl 4-(3,3-difluoro-2,6-dioxopiperidin-1-yl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 68516268 |
| Molecular Formula | C21H26F2N2O6 |
| Molecular Weight | 440.44 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | benzyl 4-(3,3-difluoro-2,6-dioxopiperidin-1-yl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)OCc1ccccc1)CN1C(=O)CCC(F)(F)C1=O |
| InChI | InChI=1S/C21H26F2N2O6/c1-20(2,3)31-19(29)24-15(11-17(27)30-13-14-7-5-4-6-8-14)12-25-16(26)9-10-21(22,23)18(25)28/h4-8,15H,9-13H2,1-3H3,(H,24,29) |
| InChIKey | KKWQPDXNXSRMTC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.44 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|