C34H38ClN3O3 — CID 68516730
[4-(aminomethyl)phenyl]-[3-[(1S)-1-(3-chloro-2-quinolin-3-ylphenyl)-1-hydroxy-5-methoxypentyl]piperidin-1-yl]methanone (PubChem CID 68516730) has the molecular formula C34H38ClN3O3 and a molecular weight of 572.15 g/mol. Its IUPAC name is [4-(aminomethyl)phenyl]-[3-[(1S)-1-(3-chloro-2-quinolin-3-ylphenyl)-1-hydroxy-5-methoxypentyl]piperidin-1-yl]methanone.
| Compound Name | [4-(aminomethyl)phenyl]-[3-[(1S)-1-(3-chloro-2-quinolin-3-ylphenyl)-1-hydroxy-5-methoxypentyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 68516730 |
| Molecular Formula | C34H38ClN3O3 |
| Molecular Weight | 572.15 g/mol |
| Exact Mass | 571.26 |
| IUPAC Name | [4-(aminomethyl)phenyl]-[3-[(1S)-1-(3-chloro-2-quinolin-3-ylphenyl)-1-hydroxy-5-methoxypentyl]piperidin-1-yl]methanone |
| SMILES | COCCCC[C@@](O)(c1cccc(Cl)c1-c1cnc2ccccc2c1)C1CCCN(C(=O)c2ccc(CN)cc2)C1 |
| InChI | InChI=1S/C34H38ClN3O3/c1-41-19-5-4-17-34(40,28-9-7-18-38(23-28)33(39)25-15-13-24(21-36)14-16-25)29-10-6-11-30(35)32(29)27-20-26-8-2-3-12-31(26)37-22-27/h2-3,6,8,10-16,20,22,28,40H,4-5,7,9,17-19,21,23,36H2,1H3/t28?,34-/m0/s1 |
| InChIKey | OODGBMZVQUUOGG-HVWQOXBCSA-N |
| XLogP | 6.57 |
| TPSA | 88.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.15 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|