About 3-(methylsulfonylmethyl)piperidine;1,3-thiazole
3-(methylsulfonylmethyl)piperidine;1,3-thiazole (PubChem CID 68516941) has the molecular formula C10H18N2O2S2
and a molecular weight of 262.40 g/mol. Its IUPAC name is 3-(methylsulfonylmethyl)piperidine;1,3-thiazole.
Molecular Properties
| Compound Name | 3-(methylsulfonylmethyl)piperidine;1,3-thiazole |
| PubChem CID | 68516941 |
| Molecular Formula | C10H18N2O2S2 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 3-(methylsulfonylmethyl)piperidine;1,3-thiazole |
| SMILES | CS(=O)(=O)CC1CCCNC1.c1cscn1 |
| InChI | InChI=1S/C7H15NO2S.C3H3NS/c1-11(9,10)6-7-3-2-4-8-5-7;1-2-5-3-4-1/h7-8H,2-6H2,1H3;1-3H |
| InChIKey | OPFHDKHWEFYULH-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(methylsulfonylmethyl)piperidine;1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(methylsulfonylmethyl)piperidine;1,3-thiazole?
The IUPAC name of 3-(methylsulfonylmethyl)piperidine;1,3-thiazole (CID 68516941) is 3-(methylsulfonylmethyl)piperidine;1,3-thiazole.
What is the SMILES notation for 3-(methylsulfonylmethyl)piperidine;1,3-thiazole?
The canonical SMILES for 3-(methylsulfonylmethyl)piperidine;1,3-thiazole is CS(=O)(=O)CC1CCCNC1.c1cscn1.
What is the InChIKey of 3-(methylsulfonylmethyl)piperidine;1,3-thiazole?
The InChIKey is OPFHDKHWEFYULH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO2S.C3H3NS/c1-11(9,10)6-7-3-2-4-8-5-7;1-2-5-3-4-1/h7-8H,2-6H2,1H3;1-3H.
What are the key properties of 3-(methylsulfonylmethyl)piperidine;1,3-thiazole?
3-(methylsulfonylmethyl)piperidine;1,3-thiazole has a molecular weight of 262.40 g/mol, XLogP of 1.17, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(methylsulfonylmethyl)piperidine;1,3-thiazole is sourced from PubChem (CID 68516941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).