About 2-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)ethylcarbamic acid
2-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)ethylcarbamic acid (PubChem CID 68516999) has the molecular formula C13H18ClN5O4
and a molecular weight of 343.77 g/mol. Its IUPAC name is 2-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)ethylcarbamic acid.
Molecular Properties
| Compound Name | 2-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)ethylcarbamic acid |
| PubChem CID | 68516999 |
| Molecular Formula | C13H18ClN5O4 |
| Molecular Weight | 343.77 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 2-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)ethylcarbamic acid |
| SMILES | CCCCCn1c(=O)n(CCNC(=O)O)c(=O)c2[nH]c(Cl)nc21 |
| InChI | InChI=1S/C13H18ClN5O4/c1-2-3-4-6-18-9-8(16-11(14)17-9)10(20)19(13(18)23)7-5-15-12(21)22/h15H,2-7H2,1H3,(H,16,17)(H,21,22) |
| InChIKey | BUQKVPQSLUMLHA-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 122.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.77 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)ethylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)ethylcarbamic acid?
The IUPAC name of 2-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)ethylcarbamic acid (CID 68516999) is 2-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)ethylcarbamic acid.
What is the SMILES notation for 2-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)ethylcarbamic acid?
The canonical SMILES for 2-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)ethylcarbamic acid is CCCCCn1c(=O)n(CCNC(=O)O)c(=O)c2[nH]c(Cl)nc21.
What is the InChIKey of 2-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)ethylcarbamic acid?
The InChIKey is BUQKVPQSLUMLHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18ClN5O4/c1-2-3-4-6-18-9-8(16-11(14)17-9)10(20)19(13(18)23)7-5-15-12(21)22/h15H,2-7H2,1H3,(H,16,17)(H,21,22).
What are the key properties of 2-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)ethylcarbamic acid?
2-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)ethylcarbamic acid has a molecular weight of 343.77 g/mol, XLogP of 1.00, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)ethylcarbamic acid is sourced from PubChem (CID 68516999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).