C14H11Cl2F3N6 — CID 68517197
N'-[4-amino-3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-5-yl]-N,N-dimethylmethanimidamide (PubChem CID 68517197) has the molecular formula C14H11Cl2F3N6 and a molecular weight of 391.18 g/mol. Its IUPAC name is N'-[4-amino-3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-5-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[4-amino-3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-5-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 68517197 |
| Molecular Formula | C14H11Cl2F3N6 |
| Molecular Weight | 391.18 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | N'-[4-amino-3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-5-yl]-N,N-dimethylmethanimidamide |
| SMILES | CN(C)C=Nc1c(N)c(C#N)nn1-c1c(Cl)cc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C14H11Cl2F3N6/c1-24(2)6-22-13-11(21)10(5-20)23-25(13)12-8(15)3-7(4-9(12)16)14(17,18)19/h3-4,6H,21H2,1-2H3 |
| InChIKey | MDAGYODOPXXDCI-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 83.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.18 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|