C11H14N4OS2 — CID 68517307
5-(methylsulfanylmethyl)-N-[(3-methylthiophen-2-yl)methyl]-2H-triazole-4-carboxamide (PubChem CID 68517307) has the molecular formula C11H14N4OS2 and a molecular weight of 282.39 g/mol. Its IUPAC name is 5-(methylsulfanylmethyl)-N-[(3-methylthiophen-2-yl)methyl]-2H-triazole-4-carboxamide.
| Compound Name | 5-(methylsulfanylmethyl)-N-[(3-methylthiophen-2-yl)methyl]-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 68517307 |
| Molecular Formula | C11H14N4OS2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 5-(methylsulfanylmethyl)-N-[(3-methylthiophen-2-yl)methyl]-2H-triazole-4-carboxamide |
| SMILES | CSCc1n[nH]nc1C(=O)NCc1sccc1C |
| InChI | InChI=1S/C11H14N4OS2/c1-7-3-4-18-9(7)5-12-11(16)10-8(6-17-2)13-15-14-10/h3-4H,5-6H2,1-2H3,(H,12,16)(H,13,14,15) |
| InChIKey | VIAVYSGDFGGOSE-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |