About 6-(2,5-diazabicyclo[2.2.1]heptan-2-yl)-2-phenyl-3-pyridin-4-ylimidazo[1,2-b]pyridazine
6-(2,5-diazabicyclo[2.2.1]heptan-2-yl)-2-phenyl-3-pyridin-4-ylimidazo[1,2-b]pyridazine (PubChem CID 68517752) has the molecular formula C22H20N6
and a molecular weight of 368.44 g/mol. Its IUPAC name is 6-(2,5-diazabicyclo[2.2.1]heptan-2-yl)-2-phenyl-3-pyridin-4-ylimidazo[1,2-b]pyridazine.
Molecular Properties
| Compound Name | 6-(2,5-diazabicyclo[2.2.1]heptan-2-yl)-2-phenyl-3-pyridin-4-ylimidazo[1,2-b]pyridazine |
| PubChem CID | 68517752 |
| Molecular Formula | C22H20N6 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 6-(2,5-diazabicyclo[2.2.1]heptan-2-yl)-2-phenyl-3-pyridin-4-ylimidazo[1,2-b]pyridazine |
| SMILES | c1ccc(-c2nc3ccc(N4CC5CC4CN5)nn3c2-c2ccncc2)cc1 |
| InChI | InChI=1S/C22H20N6/c1-2-4-15(5-3-1)21-22(16-8-10-23-11-9-16)28-19(25-21)6-7-20(26-28)27-14-17-12-18(27)13-24-17/h1-11,17-18,24H,12-14H2 |
| InChIKey | LOQNSWCDIPVRJS-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 58.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-(2,5-diazabicyclo[2.2.1]heptan-2-yl)-2-phenyl-3-pyridin-4-ylimidazo[1,2-b]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,5-diazabicyclo[2.2.1]heptan-2-yl)-2-phenyl-3-pyridin-4-ylimidazo[1,2-b]pyridazine?
The IUPAC name of 6-(2,5-diazabicyclo[2.2.1]heptan-2-yl)-2-phenyl-3-pyridin-4-ylimidazo[1,2-b]pyridazine (CID 68517752) is 6-(2,5-diazabicyclo[2.2.1]heptan-2-yl)-2-phenyl-3-pyridin-4-ylimidazo[1,2-b]pyridazine.
What is the SMILES notation for 6-(2,5-diazabicyclo[2.2.1]heptan-2-yl)-2-phenyl-3-pyridin-4-ylimidazo[1,2-b]pyridazine?
The canonical SMILES for 6-(2,5-diazabicyclo[2.2.1]heptan-2-yl)-2-phenyl-3-pyridin-4-ylimidazo[1,2-b]pyridazine is c1ccc(-c2nc3ccc(N4CC5CC4CN5)nn3c2-c2ccncc2)cc1.
What is the InChIKey of 6-(2,5-diazabicyclo[2.2.1]heptan-2-yl)-2-phenyl-3-pyridin-4-ylimidazo[1,2-b]pyridazine?
The InChIKey is LOQNSWCDIPVRJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N6/c1-2-4-15(5-3-1)21-22(16-8-10-23-11-9-16)28-19(25-21)6-7-20(26-28)27-14-17-12-18(27)13-24-17/h1-11,17-18,24H,12-14H2.
What are the key properties of 6-(2,5-diazabicyclo[2.2.1]heptan-2-yl)-2-phenyl-3-pyridin-4-ylimidazo[1,2-b]pyridazine?
6-(2,5-diazabicyclo[2.2.1]heptan-2-yl)-2-phenyl-3-pyridin-4-ylimidazo[1,2-b]pyridazine has a molecular weight of 368.44 g/mol, XLogP of 3.01, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,5-diazabicyclo[2.2.1]heptan-2-yl)-2-phenyl-3-pyridin-4-ylimidazo[1,2-b]pyridazine is sourced from PubChem (CID 68517752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).