C16H14ClN7O3 — CID 68517765
8-chloro-1-[4-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)butyl]-3,7-dihydropurine-2,6-dione (PubChem CID 68517765) has the molecular formula C16H14ClN7O3 and a molecular weight of 387.79 g/mol. Its IUPAC name is 8-chloro-1-[4-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)butyl]-3,7-dihydropurine-2,6-dione.
| Compound Name | 8-chloro-1-[4-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)butyl]-3,7-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 68517765 |
| Molecular Formula | C16H14ClN7O3 |
| Molecular Weight | 387.79 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | 8-chloro-1-[4-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)butyl]-3,7-dihydropurine-2,6-dione |
| SMILES | O=c1[nH]c2nc(Cl)[nH]c2c(=O)n1CCCCc1nc(-c2ccccn2)no1 |
| InChI | InChI=1S/C16H14ClN7O3/c17-15-20-11-13(21-15)22-16(26)24(14(11)25)8-4-2-6-10-19-12(23-27-10)9-5-1-3-7-18-9/h1,3,5,7H,2,4,6,8H2,(H,20,21)(H,22,26) |
| InChIKey | FGZYWLOPCHSHLR-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 135.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.79 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|