C15H8Br2S2 — CID 68517786
2-(dibromomethyl)-[1]benzothiolo[3,2-b][1]benzothiole (PubChem CID 68517786) has the molecular formula C15H8Br2S2 and a molecular weight of 412.17 g/mol. Its IUPAC name is 2-(dibromomethyl)-[1]benzothiolo[3,2-b][1]benzothiole.
| Compound Name | 2-(dibromomethyl)-[1]benzothiolo[3,2-b][1]benzothiole |
|---|---|
| PubChem CID | 68517786 |
| Molecular Formula | C15H8Br2S2 |
| Molecular Weight | 412.17 g/mol |
| Exact Mass | 409.84 |
| IUPAC Name | 2-(dibromomethyl)-[1]benzothiolo[3,2-b][1]benzothiole |
| SMILES | BrC(Br)c1ccc2c(c1)sc1c3ccccc3sc21 |
| InChI | InChI=1S/C15H8Br2S2/c16-15(17)8-5-6-10-12(7-8)19-13-9-3-1-2-4-11(9)18-14(10)13/h1-7,15H |
| InChIKey | FTJJXTCJKRZGGD-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.17 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|