C23H23F3N6O2 — CID 68518274
N-[2-methyl-3-[[4-[4-(2,3,4-trifluorophenoxy)piperidin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]acetamide (PubChem CID 68518274) has the molecular formula C23H23F3N6O2 and a molecular weight of 472.47 g/mol. Its IUPAC name is N-[2-methyl-3-[[4-[4-(2,3,4-trifluorophenoxy)piperidin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]acetamide.
| Compound Name | N-[2-methyl-3-[[4-[4-(2,3,4-trifluorophenoxy)piperidin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 68518274 |
| Molecular Formula | C23H23F3N6O2 |
| Molecular Weight | 472.47 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | N-[2-methyl-3-[[4-[4-(2,3,4-trifluorophenoxy)piperidin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(Nc2ncnc(N3CCC(Oc4ccc(F)c(F)c4F)CC3)n2)c1C |
| InChI | InChI=1S/C23H23F3N6O2/c1-13-17(29-14(2)33)4-3-5-18(13)30-22-27-12-28-23(31-22)32-10-8-15(9-11-32)34-19-7-6-16(24)20(25)21(19)26/h3-7,12,15H,8-11H2,1-2H3,(H,29,33)(H,27,28,30,31) |
| InChIKey | JQCBBMUXVSDEHY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|