About 5-(3,5-dichlorophenyl)-3-(3-iodo-4-methylphenyl)-5-(trifluoromethyl)-4H-1,2-oxazole
5-(3,5-dichlorophenyl)-3-(3-iodo-4-methylphenyl)-5-(trifluoromethyl)-4H-1,2-oxazole (PubChem CID 68518383) has the molecular formula C17H11Cl2F3INO
and a molecular weight of 500.09 g/mol. Its IUPAC name is 5-(3,5-dichlorophenyl)-3-(3-iodo-4-methylphenyl)-5-(trifluoromethyl)-4H-1,2-oxazole.
Molecular Properties
| Compound Name | 5-(3,5-dichlorophenyl)-3-(3-iodo-4-methylphenyl)-5-(trifluoromethyl)-4H-1,2-oxazole |
| PubChem CID | 68518383 |
| Molecular Formula | C17H11Cl2F3INO |
| Molecular Weight | 500.09 g/mol |
| Exact Mass | 498.92 |
| IUPAC Name | 5-(3,5-dichlorophenyl)-3-(3-iodo-4-methylphenyl)-5-(trifluoromethyl)-4H-1,2-oxazole |
| SMILES | Cc1ccc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)cc1I |
| InChI | InChI=1S/C17H11Cl2F3INO/c1-9-2-3-10(4-14(9)23)15-8-16(25-24-15,17(20,21)22)11-5-12(18)7-13(19)6-11/h2-7H,8H2,1H3 |
| InChIKey | WDPGFSPHLGTTHM-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 500.09 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-(3,5-dichlorophenyl)-3-(3-iodo-4-methylphenyl)-5-(trifluoromethyl)-4H-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,5-dichlorophenyl)-3-(3-iodo-4-methylphenyl)-5-(trifluoromethyl)-4H-1,2-oxazole?
The IUPAC name of 5-(3,5-dichlorophenyl)-3-(3-iodo-4-methylphenyl)-5-(trifluoromethyl)-4H-1,2-oxazole (CID 68518383) is 5-(3,5-dichlorophenyl)-3-(3-iodo-4-methylphenyl)-5-(trifluoromethyl)-4H-1,2-oxazole.
What is the SMILES notation for 5-(3,5-dichlorophenyl)-3-(3-iodo-4-methylphenyl)-5-(trifluoromethyl)-4H-1,2-oxazole?
The canonical SMILES for 5-(3,5-dichlorophenyl)-3-(3-iodo-4-methylphenyl)-5-(trifluoromethyl)-4H-1,2-oxazole is Cc1ccc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)cc1I.
What is the InChIKey of 5-(3,5-dichlorophenyl)-3-(3-iodo-4-methylphenyl)-5-(trifluoromethyl)-4H-1,2-oxazole?
The InChIKey is WDPGFSPHLGTTHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11Cl2F3INO/c1-9-2-3-10(4-14(9)23)15-8-16(25-24-15,17(20,21)22)11-5-12(18)7-13(19)6-11/h2-7H,8H2,1H3.
What are the key properties of 5-(3,5-dichlorophenyl)-3-(3-iodo-4-methylphenyl)-5-(trifluoromethyl)-4H-1,2-oxazole?
5-(3,5-dichlorophenyl)-3-(3-iodo-4-methylphenyl)-5-(trifluoromethyl)-4H-1,2-oxazole has a molecular weight of 500.09 g/mol, XLogP of 6.49, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,5-dichlorophenyl)-3-(3-iodo-4-methylphenyl)-5-(trifluoromethyl)-4H-1,2-oxazole is sourced from PubChem (CID 68518383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).