About CID 68518661
CID 68518661 (PubChem CID 68518661) has the molecular formula C22H21OSSi
and a molecular weight of 361.56 g/mol.
Molecular Properties
| Compound Name | CID 68518661 |
| PubChem CID | 68518661 |
| Molecular Formula | C22H21OSSi |
| Molecular Weight | 361.56 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | — |
| SMILES | c1ccc(Sc2ccccc2-c2ccccc2[Si]2CCCCO2)cc1 |
| InChI | InChI=1S/C22H21OSSi/c1-2-10-18(11-3-1)24-21-14-6-4-12-19(21)20-13-5-7-15-22(20)25-17-9-8-16-23-25/h1-7,10-15H,8-9,16-17H2 |
| InChIKey | IXJSDDMOMLHYNH-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 361.56 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 68518661 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 68518661?
The IUPAC name of CID 68518661 (CID 68518661) is not available.
What is the SMILES notation for CID 68518661?
The canonical SMILES for CID 68518661 is c1ccc(Sc2ccccc2-c2ccccc2[Si]2CCCCO2)cc1.
What is the InChIKey of CID 68518661?
The InChIKey is IXJSDDMOMLHYNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21OSSi/c1-2-10-18(11-3-1)24-21-14-6-4-12-19(21)20-13-5-7-15-22(20)25-17-9-8-16-23-25/h1-7,10-15H,8-9,16-17H2.
What are the key properties of CID 68518661?
CID 68518661 has a molecular weight of 361.56 g/mol, XLogP of 5.51, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 68518661 is sourced from PubChem (CID 68518661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).