C23H34O6 — CID 68518736
3-[(8R,9S,10S,13S,14S,17S)-2,2,3,3-tetrahydroxy-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2H-furan-5-one (PubChem CID 68518736) has the molecular formula C23H34O6 and a molecular weight of 406.52 g/mol. Its IUPAC name is 3-[(8R,9S,10S,13S,14S,17S)-2,2,3,3-tetrahydroxy-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2H-furan-5-one.
| Compound Name | 3-[(8R,9S,10S,13S,14S,17S)-2,2,3,3-tetrahydroxy-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2H-furan-5-one |
|---|---|
| PubChem CID | 68518736 |
| Molecular Formula | C23H34O6 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 3-[(8R,9S,10S,13S,14S,17S)-2,2,3,3-tetrahydroxy-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2H-furan-5-one |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4CC(O)(O)C(O)(O)C[C@@]43C)[C@@H]1CC[C@@H]2C1=CC(=O)OC1 |
| InChI | InChI=1S/C23H34O6/c1-20-8-7-18-15(17(20)6-5-16(20)13-9-19(24)29-11-13)4-3-14-10-22(25,26)23(27,28)12-21(14,18)2/h9,14-18,25-28H,3-8,10-12H2,1-2H3/t14?,15-,16+,17-,18-,20+,21-/m0/s1 |
| InChIKey | GFVVAWQQVCNYBY-RCCFCTDXSA-N |
| XLogP | 2.10 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|