About 1,3,4-trimethyl-1,4-dihydropyrimidin-1-ium-2-one chloride
1,3,4-trimethyl-1,4-dihydropyrimidin-1-ium-2-one chloride (PubChem CID 68518797) has the molecular formula C7H13ClN2O
and a molecular weight of 176.65 g/mol. Its IUPAC name is 1,3,4-trimethyl-1,4-dihydropyrimidin-1-ium-2-one chloride.
Molecular Properties
| Compound Name | 1,3,4-trimethyl-1,4-dihydropyrimidin-1-ium-2-one chloride |
| PubChem CID | 68518797 |
| Molecular Formula | C7H13ClN2O |
| Molecular Weight | 176.65 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 1,3,4-trimethyl-1,4-dihydropyrimidin-1-ium-2-one chloride |
| SMILES | CC1C=C[NH+](C)C(=O)N1C.[Cl-] |
| InChI | InChI=1S/C7H12N2O.ClH/c1-6-4-5-8(2)7(10)9(6)3;/h4-6H,1-3H3;1H |
| InChIKey | HTEYSTPHXXTSGE-UHFFFAOYSA-N |
| XLogP | -3.53 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.65 |
| LogP ≤ 5 | -3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,3,4-trimethyl-1,4-dihydropyrimidin-1-ium-2-one chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,4-trimethyl-1,4-dihydropyrimidin-1-ium-2-one chloride?
The IUPAC name of 1,3,4-trimethyl-1,4-dihydropyrimidin-1-ium-2-one chloride (CID 68518797) is 1,3,4-trimethyl-1,4-dihydropyrimidin-1-ium-2-one chloride.
What is the SMILES notation for 1,3,4-trimethyl-1,4-dihydropyrimidin-1-ium-2-one chloride?
The canonical SMILES for 1,3,4-trimethyl-1,4-dihydropyrimidin-1-ium-2-one chloride is CC1C=C[NH+](C)C(=O)N1C.[Cl-].
What is the InChIKey of 1,3,4-trimethyl-1,4-dihydropyrimidin-1-ium-2-one chloride?
The InChIKey is HTEYSTPHXXTSGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O.ClH/c1-6-4-5-8(2)7(10)9(6)3;/h4-6H,1-3H3;1H.
What are the key properties of 1,3,4-trimethyl-1,4-dihydropyrimidin-1-ium-2-one chloride?
1,3,4-trimethyl-1,4-dihydropyrimidin-1-ium-2-one chloride has a molecular weight of 176.65 g/mol, XLogP of -3.53, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,4-trimethyl-1,4-dihydropyrimidin-1-ium-2-one chloride is sourced from PubChem (CID 68518797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).