1,2,3-triphenylpyridin-1-ium chloride

C23H18ClN — CID 68518821

IUPAC1,2,3-triphenylpyridin-1-ium chloride
SMILES[Cl-].c1ccc(-c2ccc[n+](-c3ccccc3)c2-c2ccccc2)cc1
InChIInChI=1S/C23H18N.ClH/c1-4-11-19(12-5-1)22-17-10-18-24(21-15-8-3-9-16-21)23(22)20-13-6-2-7-14-20;/h1-18H;1H/q+1;/p-1
InChIKeyKXLCGMVLLZIKBB-UHFFFAOYSA-M
MW343.86 g/mol
LogP2.30
Rot. Bonds3

About 1,2,3-triphenylpyridin-1-ium chloride

1,2,3-triphenylpyridin-1-ium chloride (PubChem CID 68518821) has the molecular formula C23H18ClN and a molecular weight of 343.86 g/mol. Its IUPAC name is 1,2,3-triphenylpyridin-1-ium chloride.

Molecular Properties

Compound Name1,2,3-triphenylpyridin-1-ium chloride
PubChem CID68518821
Molecular FormulaC23H18ClN
Molecular Weight343.86 g/mol
Exact Mass343.11
IUPAC Name1,2,3-triphenylpyridin-1-ium chloride
SMILES[Cl-].c1ccc(-c2ccc[n+](-c3ccccc3)c2-c2ccccc2)cc1
InChIInChI=1S/C23H18N.ClH/c1-4-11-19(12-5-1)22-17-10-18-24(21-15-8-3-9-16-21)23(22)20-13-6-2-7-14-20;/h1-18H;1H/q+1;/p-1
InChIKeyKXLCGMVLLZIKBB-UHFFFAOYSA-M
XLogP2.30
TPSA3.88 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds3
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500343.86
LogP ≤ 52.30
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}

Analyze 1,2,3-triphenylpyridin-1-ium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,2,3-triphenylpyridin-1-ium chloride?
The IUPAC name of 1,2,3-triphenylpyridin-1-ium chloride (CID 68518821) is 1,2,3-triphenylpyridin-1-ium chloride.
What is the SMILES notation for 1,2,3-triphenylpyridin-1-ium chloride?
The canonical SMILES for 1,2,3-triphenylpyridin-1-ium chloride is [Cl-].c1ccc(-c2ccc[n+](-c3ccccc3)c2-c2ccccc2)cc1.
What is the InChIKey of 1,2,3-triphenylpyridin-1-ium chloride?
The InChIKey is KXLCGMVLLZIKBB-UHFFFAOYSA-M. The full InChI is InChI=1S/C23H18N.ClH/c1-4-11-19(12-5-1)22-17-10-18-24(21-15-8-3-9-16-21)23(22)20-13-6-2-7-14-20;/h1-18H;1H/q+1;/p-1.
What are the key properties of 1,2,3-triphenylpyridin-1-ium chloride?
1,2,3-triphenylpyridin-1-ium chloride has a molecular weight of 343.86 g/mol, XLogP of 2.30, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3-triphenylpyridin-1-ium chloride is sourced from PubChem (CID 68518821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).