C16H16BrN5O2 — CID 68518847
3-benzyl-6-[(5-bromo-2H-triazol-4-yl)methylidene]-1,4-dimethylpiperazine-2,5-dione (PubChem CID 68518847) has the molecular formula C16H16BrN5O2 and a molecular weight of 390.24 g/mol. Its IUPAC name is 3-benzyl-6-[(5-bromo-2H-triazol-4-yl)methylidene]-1,4-dimethylpiperazine-2,5-dione.
| Compound Name | 3-benzyl-6-[(5-bromo-2H-triazol-4-yl)methylidene]-1,4-dimethylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 68518847 |
| Molecular Formula | C16H16BrN5O2 |
| Molecular Weight | 390.24 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | 3-benzyl-6-[(5-bromo-2H-triazol-4-yl)methylidene]-1,4-dimethylpiperazine-2,5-dione |
| SMILES | CN1C(=O)C(Cc2ccccc2)N(C)C(=O)C1=Cc1n[nH]nc1Br |
| InChI | InChI=1S/C16H16BrN5O2/c1-21-12(8-10-6-4-3-5-7-10)15(23)22(2)13(16(21)24)9-11-14(17)19-20-18-11/h3-7,9,12H,8H2,1-2H3,(H,18,19,20) |
| InChIKey | INPJSJFBMVBSBR-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.24 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|