About 3-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)propyl-[2-(2-fluorophenyl)ethyl]carbamic acid
3-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)propyl-[2-(2-fluorophenyl)ethyl]carbamic acid (PubChem CID 68518919) has the molecular formula C22H27ClFN5O4
and a molecular weight of 479.94 g/mol. Its IUPAC name is 3-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)propyl-[2-(2-fluorophenyl)ethyl]carbamic acid.
Molecular Properties
| Compound Name | 3-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)propyl-[2-(2-fluorophenyl)ethyl]carbamic acid |
| PubChem CID | 68518919 |
| Molecular Formula | C22H27ClFN5O4 |
| Molecular Weight | 479.94 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | 3-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)propyl-[2-(2-fluorophenyl)ethyl]carbamic acid |
| SMILES | CCCCCn1c(=O)n(CCCN(CCc2ccccc2F)C(=O)O)c(=O)c2[nH]c(Cl)nc21 |
| InChI | InChI=1S/C22H27ClFN5O4/c1-2-3-6-12-28-18-17(25-20(23)26-18)19(30)29(21(28)31)13-7-11-27(22(32)33)14-10-15-8-4-5-9-16(15)24/h4-5,8-9H,2-3,6-7,10-14H2,1H3,(H,25,26)(H,32,33) |
| InChIKey | OJXORUCPLHWKTN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 113.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 479.94 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)propyl-[2-(2-fluorophenyl)ethyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)propyl-[2-(2-fluorophenyl)ethyl]carbamic acid?
The IUPAC name of 3-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)propyl-[2-(2-fluorophenyl)ethyl]carbamic acid (CID 68518919) is 3-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)propyl-[2-(2-fluorophenyl)ethyl]carbamic acid.
What is the SMILES notation for 3-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)propyl-[2-(2-fluorophenyl)ethyl]carbamic acid?
The canonical SMILES for 3-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)propyl-[2-(2-fluorophenyl)ethyl]carbamic acid is CCCCCn1c(=O)n(CCCN(CCc2ccccc2F)C(=O)O)c(=O)c2[nH]c(Cl)nc21.
What is the InChIKey of 3-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)propyl-[2-(2-fluorophenyl)ethyl]carbamic acid?
The InChIKey is OJXORUCPLHWKTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27ClFN5O4/c1-2-3-6-12-28-18-17(25-20(23)26-18)19(30)29(21(28)31)13-7-11-27(22(32)33)14-10-15-8-4-5-9-16(15)24/h4-5,8-9H,2-3,6-7,10-14H2,1H3,(H,25,26)(H,32,33).
What are the key properties of 3-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)propyl-[2-(2-fluorophenyl)ethyl]carbamic acid?
3-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)propyl-[2-(2-fluorophenyl)ethyl]carbamic acid has a molecular weight of 479.94 g/mol, XLogP of 3.48, 11 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)propyl-[2-(2-fluorophenyl)ethyl]carbamic acid is sourced from PubChem (CID 68518919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).