C32H35ClF3N3O3 — CID 68519152
4-[(4-chlorobenzoyl)amino]-N-[4-[4-[4-methyl-2-(1,2,2-trifluoroethoxy)phenyl]piperidin-1-yl]butyl]benzamide (PubChem CID 68519152) has the molecular formula C32H35ClF3N3O3 and a molecular weight of 602.10 g/mol. Its IUPAC name is 4-[(4-chlorobenzoyl)amino]-N-[4-[4-[4-methyl-2-(1,2,2-trifluoroethoxy)phenyl]piperidin-1-yl]butyl]benzamide.
| Compound Name | 4-[(4-chlorobenzoyl)amino]-N-[4-[4-[4-methyl-2-(1,2,2-trifluoroethoxy)phenyl]piperidin-1-yl]butyl]benzamide |
|---|---|
| PubChem CID | 68519152 |
| Molecular Formula | C32H35ClF3N3O3 |
| Molecular Weight | 602.10 g/mol |
| Exact Mass | 601.23 |
| IUPAC Name | 4-[(4-chlorobenzoyl)amino]-N-[4-[4-[4-methyl-2-(1,2,2-trifluoroethoxy)phenyl]piperidin-1-yl]butyl]benzamide |
| SMILES | Cc1ccc(C2CCN(CCCCNC(=O)c3ccc(NC(=O)c4ccc(Cl)cc4)cc3)CC2)c(OC(F)C(F)F)c1 |
| InChI | InChI=1S/C32H35ClF3N3O3/c1-21-4-13-27(28(20-21)42-30(36)29(34)35)22-14-18-39(19-15-22)17-3-2-16-37-31(40)23-7-11-26(12-8-23)38-32(41)24-5-9-25(33)10-6-24/h4-13,20,22,29-30H,2-3,14-19H2,1H3,(H,37,40)(H,38,41) |
| InChIKey | TYGDZVHAUXIHTI-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.10 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|