C26H32N4O — CID 68519485
5-(3,7-dimethylocta-2,6-dienyl)-4-N-(4-methoxyphenyl)-4-N-methylquinazoline-2,4-diamine (PubChem CID 68519485) has the molecular formula C26H32N4O and a molecular weight of 416.57 g/mol. Its IUPAC name is 5-(3,7-dimethylocta-2,6-dienyl)-4-N-(4-methoxyphenyl)-4-N-methylquinazoline-2,4-diamine.
| Compound Name | 5-(3,7-dimethylocta-2,6-dienyl)-4-N-(4-methoxyphenyl)-4-N-methylquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 68519485 |
| Molecular Formula | C26H32N4O |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | 5-(3,7-dimethylocta-2,6-dienyl)-4-N-(4-methoxyphenyl)-4-N-methylquinazoline-2,4-diamine |
| SMILES | COc1ccc(N(C)c2nc(N)nc3cccc(CC=C(C)CCC=C(C)C)c23)cc1 |
| InChI | InChI=1S/C26H32N4O/c1-18(2)8-6-9-19(3)12-13-20-10-7-11-23-24(20)25(29-26(27)28-23)30(4)21-14-16-22(31-5)17-15-21/h7-8,10-12,14-17H,6,9,13H2,1-5H3,(H2,27,28,29) |
| InChIKey | SFSIFFYDXUEHSJ-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|